C18H11BrClF3N2O2 — CID 90831668
1-(4-bromo-7-hydroxynaphthalen-1-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 90831668) has the molecular formula C18H11BrClF3N2O2 and a molecular weight of 459.65 g/mol. Its IUPAC name is 1-(4-bromo-7-hydroxynaphthalen-1-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-bromo-7-hydroxynaphthalen-1-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90831668 |
| Molecular Formula | C18H11BrClF3N2O2 |
| Molecular Weight | 459.65 g/mol |
| Exact Mass | 457.96 |
| IUPAC Name | 1-(4-bromo-7-hydroxynaphthalen-1-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)Nc1ccc(Br)c2ccc(O)cc12 |
| InChI | InChI=1S/C18H11BrClF3N2O2/c19-14-4-6-16(12-8-10(26)2-3-11(12)14)25-17(27)24-9-1-5-15(20)13(7-9)18(21,22)23/h1-8,26H,(H2,24,25,27) |
| InChIKey | CIDOSXCTKSJPOY-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |