C12H7BrClF3N2O2 — CID 108872890
1-(5-bromofuran-2-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 108872890) has the molecular formula C12H7BrClF3N2O2 and a molecular weight of 383.55 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(5-bromofuran-2-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 108872890 |
| Molecular Formula | C12H7BrClF3N2O2 |
| Molecular Weight | 383.55 g/mol |
| Exact Mass | 381.93 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)Nc1ccc(Br)o1 |
| InChI | InChI=1S/C12H7BrClF3N2O2/c13-9-3-4-10(21-9)19-11(20)18-6-1-2-8(14)7(5-6)12(15,16)17/h1-5H,(H2,18,19,20) |
| InChIKey | ASLDSWMZUGKLLU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |