C15H9ClF6N2O4S — CID 19433252
[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl] trifluoromethanesulfonate (PubChem CID 19433252) has the molecular formula C15H9ClF6N2O4S and a molecular weight of 462.76 g/mol. Its IUPAC name is [4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 19433252 |
| Molecular Formula | C15H9ClF6N2O4S |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | [4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl] trifluoromethanesulfonate |
| SMILES | O=C(Nc1ccc(OS(=O)(=O)C(F)(F)F)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9ClF6N2O4S/c16-12-6-3-9(7-11(12)14(17,18)19)24-13(25)23-8-1-4-10(5-2-8)28-29(26,27)15(20,21)22/h1-7H,(H2,23,24,25) |
| InChIKey | QZXMYNCSVKWYGP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|