C15H9ClF6N2O2 — CID 19433222
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-hydroxy-3-(trifluoromethyl)phenyl]urea (PubChem CID 19433222) has the molecular formula C15H9ClF6N2O2 and a molecular weight of 398.69 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-hydroxy-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-hydroxy-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 19433222 |
| Molecular Formula | C15H9ClF6N2O2 |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-hydroxy-3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(O)c(C(F)(F)F)c1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9ClF6N2O2/c16-11-3-1-7(5-9(11)14(17,18)19)23-13(26)24-8-2-4-12(25)10(6-8)15(20,21)22/h1-6,25H,(H2,23,24,26) |
| InChIKey | HKUMVIXHPAFTCJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|