C15H12ClF3N2O2 — CID 97455774
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(3-methoxyphenyl)urea (PubChem CID 97455774) has the molecular formula C15H12ClF3N2O2 and a molecular weight of 344.72 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 97455774 |
| Molecular Formula | C15H12ClF3N2O2 |
| Molecular Weight | 344.72 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H12ClF3N2O2/c1-23-11-4-2-3-9(7-11)20-14(22)21-10-5-6-13(16)12(8-10)15(17,18)19/h2-8H,1H3,(H2,20,21,22) |
| InChIKey | HEOGJZFUBNTVNG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.72 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |