C22H13Cl2F3N4O2 — CID 155810717
1-[3-(4-chlorophthalazin-1-yl)oxyphenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 155810717) has the molecular formula C22H13Cl2F3N4O2 and a molecular weight of 493.27 g/mol. Its IUPAC name is 1-[3-(4-chlorophthalazin-1-yl)oxyphenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-(4-chlorophthalazin-1-yl)oxyphenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 155810717 |
| Molecular Formula | C22H13Cl2F3N4O2 |
| Molecular Weight | 493.27 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | 1-[3-(4-chlorophthalazin-1-yl)oxyphenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(Oc2nnc(Cl)c3ccccc23)c1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H13Cl2F3N4O2/c23-18-9-8-13(11-17(18)22(25,26)27)29-21(32)28-12-4-3-5-14(10-12)33-20-16-7-2-1-6-15(16)19(24)30-31-20/h1-11H,(H2,28,29,32) |
| InChIKey | ZPCDGMGJFZRIKK-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.27 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |