C22H16ClF3N2O4 — CID 56836646
3-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-3-methylphenoxy]benzoic acid (PubChem CID 56836646) has the molecular formula C22H16ClF3N2O4 and a molecular weight of 464.83 g/mol. Its IUPAC name is 3-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-3-methylphenoxy]benzoic acid.
| Compound Name | 3-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-3-methylphenoxy]benzoic acid |
|---|---|
| PubChem CID | 56836646 |
| Molecular Formula | C22H16ClF3N2O4 |
| Molecular Weight | 464.83 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 3-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-3-methylphenoxy]benzoic acid |
| SMILES | Cc1cc(Oc2cccc(C(=O)O)c2)ccc1NC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H16ClF3N2O4/c1-12-9-16(32-15-4-2-3-13(10-15)20(29)30)6-8-19(12)28-21(31)27-14-5-7-18(23)17(11-14)22(24,25)26/h2-11H,1H3,(H,29,30)(H2,27,28,31) |
| InChIKey | PCWJMORMCRLARY-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.83 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |