C21H14ClF3N4O3 — CID 175029285
3-[[2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]diazenyl]benzoic acid (PubChem CID 175029285) has the molecular formula C21H14ClF3N4O3 and a molecular weight of 462.82 g/mol. Its IUPAC name is 3-[[2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]diazenyl]benzoic acid.
| Compound Name | 3-[[2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 175029285 |
| Molecular Formula | C21H14ClF3N4O3 |
| Molecular Weight | 462.82 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 3-[[2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]diazenyl]benzoic acid |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)Nc1ccccc1/N=N\c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C21H14ClF3N4O3/c22-16-9-8-13(11-15(16)21(23,24)25)26-20(32)27-17-6-1-2-7-18(17)29-28-14-5-3-4-12(10-14)19(30)31/h1-11H,(H,30,31)(H2,26,27,32)/b29-28- |
| InChIKey | PAYAMHWLNZREAJ-ZIADKAODSA-N |
| XLogP | 7.12 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.82 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|