C16H11ClF3NO2 — CID 727661
N-[4-chloro-3-(trifluoromethyl)phenyl]-3-oxo-3-phenylpropanamide (PubChem CID 727661) has the molecular formula C16H11ClF3NO2 and a molecular weight of 341.72 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-3-oxo-3-phenylpropanamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-oxo-3-phenylpropanamide |
|---|---|
| PubChem CID | 727661 |
| Molecular Formula | C16H11ClF3NO2 |
| Molecular Weight | 341.72 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-oxo-3-phenylpropanamide |
| SMILES | O=C(CC(=O)c1ccccc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11ClF3NO2/c17-13-7-6-11(8-12(13)16(18,19)20)21-15(23)9-14(22)10-4-2-1-3-5-10/h1-8H,9H2,(H,21,23) |
| InChIKey | GLSAXNHRDBFGFY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.72 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|