C17H16ClF3N2O — CID 84867134
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(1-phenylethylamino)acetamide (PubChem CID 84867134) has the molecular formula C17H16ClF3N2O and a molecular weight of 356.78 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(1-phenylethylamino)acetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(1-phenylethylamino)acetamide |
|---|---|
| PubChem CID | 84867134 |
| Molecular Formula | C17H16ClF3N2O |
| Molecular Weight | 356.78 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(1-phenylethylamino)acetamide |
| SMILES | CC(NCC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C17H16ClF3N2O/c1-11(12-5-3-2-4-6-12)22-10-16(24)23-13-7-8-15(18)14(9-13)17(19,20)21/h2-9,11,22H,10H2,1H3,(H,23,24) |
| InChIKey | RTOXWBYRDCFCSB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.78 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |