C22H16ClF3N4O2 — CID 151516113
1-[4-[(3-acetylphenyl)diazenyl]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 151516113) has the molecular formula C22H16ClF3N4O2 and a molecular weight of 460.84 g/mol. Its IUPAC name is 1-[4-[(3-acetylphenyl)diazenyl]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[(3-acetylphenyl)diazenyl]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 151516113 |
| Molecular Formula | C22H16ClF3N4O2 |
| Molecular Weight | 460.84 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 1-[4-[(3-acetylphenyl)diazenyl]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | CC(=O)c1cccc(/N=N/c2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)c1 |
| InChI | InChI=1S/C22H16ClF3N4O2/c1-13(31)14-3-2-4-18(11-14)30-29-16-7-5-15(6-8-16)27-21(32)28-17-9-10-20(23)19(12-17)22(24,25)26/h2-12H,1H3,(H2,27,28,32)/b30-29+ |
| InChIKey | PTMOGMNHKABLPC-QVIHXGFCSA-N |
| XLogP | 7.62 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.84 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|