C18H15ClF3NO2S — CID 7363945
(2S)-N-(3-acetylphenyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylpropanamide (PubChem CID 7363945) has the molecular formula C18H15ClF3NO2S and a molecular weight of 401.84 g/mol. Its IUPAC name is (2S)-N-(3-acetylphenyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylpropanamide.
| Compound Name | (2S)-N-(3-acetylphenyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7363945 |
| Molecular Formula | C18H15ClF3NO2S |
| Molecular Weight | 401.84 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | (2S)-N-(3-acetylphenyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylpropanamide |
| SMILES | CC(=O)c1cccc(NC(=O)[C@H](C)Sc2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H15ClF3NO2S/c1-10(24)12-4-3-5-13(8-12)23-17(25)11(2)26-14-6-7-16(19)15(9-14)18(20,21)22/h3-9,11H,1-2H3,(H,23,25)/t11-/m0/s1 |
| InChIKey | FNZCKVGXEXGJKF-NSHDSACASA-N |
| XLogP | 5.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.84 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |