C13H14ClF3N2O2S — CID 51468554
(2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(ethylcarbamoyl)propanamide (PubChem CID 51468554) has the molecular formula C13H14ClF3N2O2S and a molecular weight of 354.78 g/mol. Its IUPAC name is (2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(ethylcarbamoyl)propanamide.
| Compound Name | (2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(ethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 51468554 |
| Molecular Formula | C13H14ClF3N2O2S |
| Molecular Weight | 354.78 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | (2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(ethylcarbamoyl)propanamide |
| SMILES | CCNC(=O)NC(=O)[C@@H](C)Sc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14ClF3N2O2S/c1-3-18-12(21)19-11(20)7(2)22-8-4-5-10(14)9(6-8)13(15,16)17/h4-7H,3H2,1-2H3,(H2,18,19,20,21)/t7-/m1/s1 |
| InChIKey | BDPQXJJRCPPBOI-SSDOTTSWSA-N |
| XLogP | 3.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.78 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |