C17H18ClF3N2OS — CID 9288919
(2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(1-cyanocyclohexyl)propanamide (PubChem CID 9288919) has the molecular formula C17H18ClF3N2OS and a molecular weight of 390.86 g/mol. Its IUPAC name is (2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(1-cyanocyclohexyl)propanamide.
| Compound Name | (2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(1-cyanocyclohexyl)propanamide |
|---|---|
| PubChem CID | 9288919 |
| Molecular Formula | C17H18ClF3N2OS |
| Molecular Weight | 390.86 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(1-cyanocyclohexyl)propanamide |
| SMILES | C[C@@H](Sc1ccc(Cl)c(C(F)(F)F)c1)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C17H18ClF3N2OS/c1-11(15(24)23-16(10-22)7-3-2-4-8-16)25-12-5-6-14(18)13(9-12)17(19,20)21/h5-6,9,11H,2-4,7-8H2,1H3,(H,23,24)/t11-/m1/s1 |
| InChIKey | REQSCMOMDONJCY-LLVKDONJSA-N |
| XLogP | 5.18 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.86 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |