C15H11Cl2F3N2OS — CID 7397776
(2R)-N-(5-chloro-2-pyridinyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylpropanamide (PubChem CID 7397776) has the molecular formula C15H11Cl2F3N2OS and a molecular weight of 395.23 g/mol. Its IUPAC name is (2R)-N-(5-chloro-2-pyridinyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylpropanamide.
| Compound Name | (2R)-N-(5-chloro-2-pyridinyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7397776 |
| Molecular Formula | C15H11Cl2F3N2OS |
| Molecular Weight | 395.23 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | (2R)-N-(5-chloro-2-pyridinyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylpropanamide |
| SMILES | C[C@@H](Sc1ccc(Cl)c(C(F)(F)F)c1)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H11Cl2F3N2OS/c1-8(14(23)22-13-5-2-9(16)7-21-13)24-10-3-4-12(17)11(6-10)15(18,19)20/h2-8H,1H3,(H,21,22,23)/t8-/m1/s1 |
| InChIKey | QYCSAJVBTUGWNB-MRVPVSSYSA-N |
| XLogP | 5.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.23 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |