C17H15ClF3NO2S — CID 16514508
2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(2-methoxyphenyl)propanamide (PubChem CID 16514508) has the molecular formula C17H15ClF3NO2S and a molecular weight of 389.83 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(2-methoxyphenyl)propanamide.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 16514508 |
| Molecular Formula | C17H15ClF3NO2S |
| Molecular Weight | 389.83 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanyl-N-(2-methoxyphenyl)propanamide |
| SMILES | COc1ccccc1NC(=O)C(C)Sc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15ClF3NO2S/c1-10(16(23)22-14-5-3-4-6-15(14)24-2)25-11-7-8-13(18)12(9-11)17(19,20)21/h3-10H,1-2H3,(H,22,23) |
| InChIKey | CIZLGHXNSQXZIN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.83 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |