C16H15F2NO2S — CID 9046467
(2R)-2-(2,4-difluorophenyl)sulfanyl-N-(2-methoxyphenyl)propanamide (PubChem CID 9046467) has the molecular formula C16H15F2NO2S and a molecular weight of 323.36 g/mol. Its IUPAC name is (2R)-2-(2,4-difluorophenyl)sulfanyl-N-(2-methoxyphenyl)propanamide.
| Compound Name | (2R)-2-(2,4-difluorophenyl)sulfanyl-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 9046467 |
| Molecular Formula | C16H15F2NO2S |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (2R)-2-(2,4-difluorophenyl)sulfanyl-N-(2-methoxyphenyl)propanamide |
| SMILES | COc1ccccc1NC(=O)[C@@H](C)Sc1ccc(F)cc1F |
| InChI | InChI=1S/C16H15F2NO2S/c1-10(22-15-8-7-11(17)9-12(15)18)16(20)19-13-5-3-4-6-14(13)21-2/h3-10H,1-2H3,(H,19,20)/t10-/m1/s1 |
| InChIKey | VUEUYTCATPQGHE-SNVBAGLBSA-N |
| XLogP | 4.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |