C15H12F3NOS — CID 8870293
(2R)-2-(2,5-difluorophenyl)sulfanyl-N-(2-fluorophenyl)propanamide (PubChem CID 8870293) has the molecular formula C15H12F3NOS and a molecular weight of 311.33 g/mol. Its IUPAC name is (2R)-2-(2,5-difluorophenyl)sulfanyl-N-(2-fluorophenyl)propanamide.
| Compound Name | (2R)-2-(2,5-difluorophenyl)sulfanyl-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 8870293 |
| Molecular Formula | C15H12F3NOS |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (2R)-2-(2,5-difluorophenyl)sulfanyl-N-(2-fluorophenyl)propanamide |
| SMILES | C[C@@H](Sc1cc(F)ccc1F)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C15H12F3NOS/c1-9(21-14-8-10(16)6-7-12(14)18)15(20)19-13-5-3-2-4-11(13)17/h2-9H,1H3,(H,19,20)/t9-/m1/s1 |
| InChIKey | YDRMTRYLHWCYMG-SECBINFHSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |