2-(2,5-difluorophenyl)sulfanylpropanoic acid

C9H8F2O2S — CID 16772336

IUPAC2-(2,5-difluorophenyl)sulfanylpropanoic acid
SMILESCC(Sc1cc(F)ccc1F)C(=O)O
InChIInChI=1S/C9H8F2O2S/c1-5(9(12)13)14-8-4-6(10)2-3-7(8)11/h2-5H,1H3,(H,12,13)
InChIKeyXPSOEFXOXMIAKJ-UHFFFAOYSA-N
MW218.22 g/mol
LogP2.53
Rot. Bonds3

About 2-(2,5-difluorophenyl)sulfanylpropanoic acid

2-(2,5-difluorophenyl)sulfanylpropanoic acid (PubChem CID 16772336) has the molecular formula C9H8F2O2S and a molecular weight of 218.22 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)sulfanylpropanoic acid.

Molecular Properties

Compound Name2-(2,5-difluorophenyl)sulfanylpropanoic acid
PubChem CID16772336
Molecular FormulaC9H8F2O2S
Molecular Weight218.22 g/mol
Exact Mass218.02
IUPAC Name2-(2,5-difluorophenyl)sulfanylpropanoic acid
SMILESCC(Sc1cc(F)ccc1F)C(=O)O
InChIInChI=1S/C9H8F2O2S/c1-5(9(12)13)14-8-4-6(10)2-3-7(8)11/h2-5H,1H3,(H,12,13)
InChIKeyXPSOEFXOXMIAKJ-UHFFFAOYSA-N
XLogP2.53
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.22
LogP ≤ 52.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(2,5-difluorophenyl)sulfanylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-difluorophenyl)sulfanylpropanoic acid?
The IUPAC name of 2-(2,5-difluorophenyl)sulfanylpropanoic acid (CID 16772336) is 2-(2,5-difluorophenyl)sulfanylpropanoic acid.
What is the SMILES notation for 2-(2,5-difluorophenyl)sulfanylpropanoic acid?
The canonical SMILES for 2-(2,5-difluorophenyl)sulfanylpropanoic acid is CC(Sc1cc(F)ccc1F)C(=O)O.
What is the InChIKey of 2-(2,5-difluorophenyl)sulfanylpropanoic acid?
The InChIKey is XPSOEFXOXMIAKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2O2S/c1-5(9(12)13)14-8-4-6(10)2-3-7(8)11/h2-5H,1H3,(H,12,13).
What are the key properties of 2-(2,5-difluorophenyl)sulfanylpropanoic acid?
2-(2,5-difluorophenyl)sulfanylpropanoic acid has a molecular weight of 218.22 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-difluorophenyl)sulfanylpropanoic acid is sourced from PubChem (CID 16772336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).