C10H10F2N2O2S — CID 8870554
(2S)-N-carbamoyl-2-(2,5-difluorophenyl)sulfanylpropanamide (PubChem CID 8870554) has the molecular formula C10H10F2N2O2S and a molecular weight of 260.26 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-(2,5-difluorophenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-carbamoyl-2-(2,5-difluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 8870554 |
| Molecular Formula | C10H10F2N2O2S |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | (2S)-N-carbamoyl-2-(2,5-difluorophenyl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1cc(F)ccc1F)C(=O)NC(N)=O |
| InChI | InChI=1S/C10H10F2N2O2S/c1-5(9(15)14-10(13)16)17-8-4-6(11)2-3-7(8)12/h2-5H,1H3,(H3,13,14,15,16)/t5-/m0/s1 |
| InChIKey | GRGKJYJVPCIPAX-YFKPBYRVSA-N |
| XLogP | 1.64 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |