C16H20F2N2O2S — CID 8870587
(2S)-N-(cyclohexylcarbamoyl)-2-(2,5-difluorophenyl)sulfanylpropanamide (PubChem CID 8870587) has the molecular formula C16H20F2N2O2S and a molecular weight of 342.41 g/mol. Its IUPAC name is (2S)-N-(cyclohexylcarbamoyl)-2-(2,5-difluorophenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-(cyclohexylcarbamoyl)-2-(2,5-difluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 8870587 |
| Molecular Formula | C16H20F2N2O2S |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (2S)-N-(cyclohexylcarbamoyl)-2-(2,5-difluorophenyl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1cc(F)ccc1F)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H20F2N2O2S/c1-10(23-14-9-11(17)7-8-13(14)18)15(21)20-16(22)19-12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3,(H2,19,20,21,22)/t10-/m0/s1 |
| InChIKey | FCOLSCAMPRIETF-JTQLQIEISA-N |
| XLogP | 3.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |