C15H19Cl2NOS — CID 7870552
(2R)-N-cyclohexyl-2-(2,5-dichlorophenyl)sulfanylpropanamide (PubChem CID 7870552) has the molecular formula C15H19Cl2NOS and a molecular weight of 332.30 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-(2,5-dichlorophenyl)sulfanylpropanamide.
| Compound Name | (2R)-N-cyclohexyl-2-(2,5-dichlorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7870552 |
| Molecular Formula | C15H19Cl2NOS |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | (2R)-N-cyclohexyl-2-(2,5-dichlorophenyl)sulfanylpropanamide |
| SMILES | C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H19Cl2NOS/c1-10(15(19)18-12-5-3-2-4-6-12)20-14-9-11(16)7-8-13(14)17/h7-10,12H,2-6H2,1H3,(H,18,19)/t10-/m1/s1 |
| InChIKey | KMRDQILTFQPQSU-SNVBAGLBSA-N |
| XLogP | 4.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |