C12H14ClNOS — CID 883001
(2R)-2-(4-chlorophenyl)sulfanyl-N-cyclopropylpropanamide (PubChem CID 883001) has the molecular formula C12H14ClNOS and a molecular weight of 255.77 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)sulfanyl-N-cyclopropylpropanamide.
| Compound Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 883001 |
| Molecular Formula | C12H14ClNOS |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-cyclopropylpropanamide |
| SMILES | C[C@@H](Sc1ccc(Cl)cc1)C(=O)NC1CC1 |
| InChI | InChI=1S/C12H14ClNOS/c1-8(12(15)14-10-4-5-10)16-11-6-2-9(13)3-7-11/h2-3,6-8,10H,4-5H2,1H3,(H,14,15)/t8-/m1/s1 |
| InChIKey | CGMLWEIWPBVFFT-MRVPVSSYSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |