C13H16ClNO3S2 — CID 51073679
2-(4-chlorophenyl)sulfanyl-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 51073679) has the molecular formula C13H16ClNO3S2 and a molecular weight of 333.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 51073679 |
| Molecular Formula | C13H16ClNO3S2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CC(Sc1ccc(Cl)cc1)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16ClNO3S2/c1-9(19-12-4-2-10(14)3-5-12)13(16)15-11-6-7-20(17,18)8-11/h2-5,9,11H,6-8H2,1H3,(H,15,16) |
| InChIKey | DUTZLLYBDUIUGR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |