C14H17ClN2O2S — CID 18163880
2-(4-chlorophenyl)sulfanyl-N-[2-(cyclopropylamino)-2-oxoethyl]propanamide (PubChem CID 18163880) has the molecular formula C14H17ClN2O2S and a molecular weight of 312.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[2-(cyclopropylamino)-2-oxoethyl]propanamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[2-(cyclopropylamino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 18163880 |
| Molecular Formula | C14H17ClN2O2S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[2-(cyclopropylamino)-2-oxoethyl]propanamide |
| SMILES | CC(Sc1ccc(Cl)cc1)C(=O)NCC(=O)NC1CC1 |
| InChI | InChI=1S/C14H17ClN2O2S/c1-9(20-12-6-2-10(15)3-7-12)14(19)16-8-13(18)17-11-4-5-11/h2-3,6-7,9,11H,4-5,8H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | YWYQBJSJXCUCHT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |