C13H15F2NO3S2 — CID 24500088
2-(2,5-difluorophenyl)sulfanyl-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 24500088) has the molecular formula C13H15F2NO3S2 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)sulfanyl-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 2-(2,5-difluorophenyl)sulfanyl-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 24500088 |
| Molecular Formula | C13H15F2NO3S2 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-(2,5-difluorophenyl)sulfanyl-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CC(Sc1cc(F)ccc1F)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15F2NO3S2/c1-8(20-12-6-9(14)2-3-11(12)15)13(17)16-10-4-5-21(18,19)7-10/h2-3,6,8,10H,4-5,7H2,1H3,(H,16,17) |
| InChIKey | GVAREONDHNXSBR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |