C14H18Cl2N2OS — CID 119512562
2-(2,5-dichlorophenyl)sulfanyl-N-(pyrrolidin-2-ylmethyl)propanamide (PubChem CID 119512562) has the molecular formula C14H18Cl2N2OS and a molecular weight of 333.28 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-(pyrrolidin-2-ylmethyl)propanamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(pyrrolidin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 119512562 |
| Molecular Formula | C14H18Cl2N2OS |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(pyrrolidin-2-ylmethyl)propanamide |
| SMILES | CC(Sc1cc(Cl)ccc1Cl)C(=O)NCC1CCCN1 |
| InChI | InChI=1S/C14H18Cl2N2OS/c1-9(14(19)18-8-11-3-2-6-17-11)20-13-7-10(15)4-5-12(13)16/h4-5,7,9,11,17H,2-3,6,8H2,1H3,(H,18,19) |
| InChIKey | KXODSHFROWNDNN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |