C15H18F2N2O2S — CID 8975280
(2R)-N-(cyclopentylcarbamoyl)-2-(2,4-difluorophenyl)sulfanylpropanamide (PubChem CID 8975280) has the molecular formula C15H18F2N2O2S and a molecular weight of 328.38 g/mol. Its IUPAC name is (2R)-N-(cyclopentylcarbamoyl)-2-(2,4-difluorophenyl)sulfanylpropanamide.
| Compound Name | (2R)-N-(cyclopentylcarbamoyl)-2-(2,4-difluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 8975280 |
| Molecular Formula | C15H18F2N2O2S |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (2R)-N-(cyclopentylcarbamoyl)-2-(2,4-difluorophenyl)sulfanylpropanamide |
| SMILES | C[C@@H](Sc1ccc(F)cc1F)C(=O)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H18F2N2O2S/c1-9(22-13-7-6-10(16)8-12(13)17)14(20)19-15(21)18-11-4-2-3-5-11/h6-9,11H,2-5H2,1H3,(H2,18,19,20,21)/t9-/m1/s1 |
| InChIKey | HNWZXTPBMAZXPX-SECBINFHSA-N |
| XLogP | 3.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |