C12H14F2N2O2S — CID 47115223
N-carbamoyl-2-(2,4-difluorophenyl)sulfanyl-3-methylbutanamide (PubChem CID 47115223) has the molecular formula C12H14F2N2O2S and a molecular weight of 288.32 g/mol. Its IUPAC name is N-carbamoyl-2-(2,4-difluorophenyl)sulfanyl-3-methylbutanamide.
| Compound Name | N-carbamoyl-2-(2,4-difluorophenyl)sulfanyl-3-methylbutanamide |
|---|---|
| PubChem CID | 47115223 |
| Molecular Formula | C12H14F2N2O2S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-carbamoyl-2-(2,4-difluorophenyl)sulfanyl-3-methylbutanamide |
| SMILES | CC(C)C(Sc1ccc(F)cc1F)C(=O)NC(N)=O |
| InChI | InChI=1S/C12H14F2N2O2S/c1-6(2)10(11(17)16-12(15)18)19-9-4-3-7(13)5-8(9)14/h3-6,10H,1-2H3,(H3,15,16,17,18) |
| InChIKey | SUQADMIHUMVGKD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |