C10H11F2NOS — CID 62899928
2-(2,4-difluorophenyl)sulfanylbutanamide (PubChem CID 62899928) has the molecular formula C10H11F2NOS and a molecular weight of 231.27 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanylbutanamide.
| Compound Name | 2-(2,4-difluorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 62899928 |
| Molecular Formula | C10H11F2NOS |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanylbutanamide |
| SMILES | CCC(Sc1ccc(F)cc1F)C(N)=O |
| InChI | InChI=1S/C10H11F2NOS/c1-2-8(10(13)14)15-9-4-3-6(11)5-7(9)12/h3-5,8H,2H2,1H3,(H2,13,14) |
| InChIKey | CCRXPHBSYSHTNQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |