C15H11ClF2OS — CID 43224788
1-(4-chlorophenyl)-2-(2,4-difluorophenyl)sulfanylpropan-1-one (PubChem CID 43224788) has the molecular formula C15H11ClF2OS and a molecular weight of 312.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(2,4-difluorophenyl)sulfanylpropan-1-one.
| Compound Name | 1-(4-chlorophenyl)-2-(2,4-difluorophenyl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 43224788 |
| Molecular Formula | C15H11ClF2OS |
| Molecular Weight | 312.77 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(2,4-difluorophenyl)sulfanylpropan-1-one |
| SMILES | CC(Sc1ccc(F)cc1F)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClF2OS/c1-9(15(19)10-2-4-11(16)5-3-10)20-14-7-6-12(17)8-13(14)18/h2-9H,1H3 |
| InChIKey | NYDYDTKWMFJLLW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.77 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |