C16H14F2N2O2S — CID 9046418
4-[[(2R)-2-(2,4-difluorophenyl)sulfanylpropanoyl]amino]benzamide (PubChem CID 9046418) has the molecular formula C16H14F2N2O2S and a molecular weight of 336.36 g/mol. Its IUPAC name is 4-[[(2R)-2-(2,4-difluorophenyl)sulfanylpropanoyl]amino]benzamide.
| Compound Name | 4-[[(2R)-2-(2,4-difluorophenyl)sulfanylpropanoyl]amino]benzamide |
|---|---|
| PubChem CID | 9046418 |
| Molecular Formula | C16H14F2N2O2S |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 4-[[(2R)-2-(2,4-difluorophenyl)sulfanylpropanoyl]amino]benzamide |
| SMILES | C[C@@H](Sc1ccc(F)cc1F)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C16H14F2N2O2S/c1-9(23-14-7-4-11(17)8-13(14)18)16(22)20-12-5-2-10(3-6-12)15(19)21/h2-9H,1H3,(H2,19,21)(H,20,22)/t9-/m1/s1 |
| InChIKey | VUNDMGACZDFQTF-SECBINFHSA-N |
| XLogP | 3.18 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |