C15H14F2N2OS — CID 43345467
N-(4-aminophenyl)-2-(2,4-difluorophenyl)sulfanylpropanamide (PubChem CID 43345467) has the molecular formula C15H14F2N2OS and a molecular weight of 308.35 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-(2,4-difluorophenyl)sulfanylpropanamide.
| Compound Name | N-(4-aminophenyl)-2-(2,4-difluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 43345467 |
| Molecular Formula | C15H14F2N2OS |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-(4-aminophenyl)-2-(2,4-difluorophenyl)sulfanylpropanamide |
| SMILES | CC(Sc1ccc(F)cc1F)C(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C15H14F2N2OS/c1-9(21-14-7-2-10(16)8-13(14)17)15(20)19-12-5-3-11(18)4-6-12/h2-9H,18H2,1H3,(H,19,20) |
| InChIKey | ARAWHPPGCUKNAA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|