C15H11Cl2F2NOS — CID 55387332
N-(2,3-dichlorophenyl)-2-(2,4-difluorophenyl)sulfanylpropanamide (PubChem CID 55387332) has the molecular formula C15H11Cl2F2NOS and a molecular weight of 362.23 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(2,4-difluorophenyl)sulfanylpropanamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(2,4-difluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 55387332 |
| Molecular Formula | C15H11Cl2F2NOS |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(2,4-difluorophenyl)sulfanylpropanamide |
| SMILES | CC(Sc1ccc(F)cc1F)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H11Cl2F2NOS/c1-8(22-13-6-5-9(18)7-11(13)19)15(21)20-12-4-2-3-10(16)14(12)17/h2-8H,1H3,(H,20,21) |
| InChIKey | CAHNQDHYJNPEDY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |