C15H13Cl2NOS — CID 2955781
N-(2,3-dichlorophenyl)-2-phenylsulfanylpropanamide (PubChem CID 2955781) has the molecular formula C15H13Cl2NOS and a molecular weight of 326.25 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-phenylsulfanylpropanamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 2955781 |
| Molecular Formula | C15H13Cl2NOS |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-phenylsulfanylpropanamide |
| SMILES | CC(Sc1ccccc1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H13Cl2NOS/c1-10(20-11-6-3-2-4-7-11)15(19)18-13-9-5-8-12(16)14(13)17/h2-10H,1H3,(H,18,19) |
| InChIKey | NYXKNLXCZHRSLZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |