C10H12ClNOS — CID 38010728
(2R)-2-(4-chlorophenyl)sulfanylbutanamide (PubChem CID 38010728) has the molecular formula C10H12ClNOS and a molecular weight of 229.73 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)sulfanylbutanamide.
| Compound Name | (2R)-2-(4-chlorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 38010728 |
| Molecular Formula | C10H12ClNOS |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)sulfanylbutanamide |
| SMILES | CC[C@@H](Sc1ccc(Cl)cc1)C(N)=O |
| InChI | InChI=1S/C10H12ClNOS/c1-2-9(10(12)13)14-8-5-3-7(11)4-6-8/h3-6,9H,2H2,1H3,(H2,12,13)/t9-/m1/s1 |
| InChIKey | ZCXOQPALMKVZTN-SECBINFHSA-N |
| XLogP | 2.70 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |