C16H22ClNOS — CID 132760366
2-(4-chlorophenyl)sulfanyl-1-(3-methylpiperidin-1-yl)butan-1-one (PubChem CID 132760366) has the molecular formula C16H22ClNOS and a molecular weight of 311.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-1-(3-methylpiperidin-1-yl)butan-1-one.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-1-(3-methylpiperidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 132760366 |
| Molecular Formula | C16H22ClNOS |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-1-(3-methylpiperidin-1-yl)butan-1-one |
| SMILES | CCC(Sc1ccc(Cl)cc1)C(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C16H22ClNOS/c1-3-15(20-14-8-6-13(17)7-9-14)16(19)18-10-4-5-12(2)11-18/h6-9,12,15H,3-5,10-11H2,1-2H3 |
| InChIKey | JMZCDEGPILBSKP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |