C21H24Cl2N2OS — CID 28572840
(2R)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-(4-chlorophenyl)sulfanylbutan-1-one (PubChem CID 28572840) has the molecular formula C21H24Cl2N2OS and a molecular weight of 423.41 g/mol. Its IUPAC name is (2R)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-(4-chlorophenyl)sulfanylbutan-1-one.
| Compound Name | (2R)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-(4-chlorophenyl)sulfanylbutan-1-one |
|---|---|
| PubChem CID | 28572840 |
| Molecular Formula | C21H24Cl2N2OS |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | (2R)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-(4-chlorophenyl)sulfanylbutan-1-one |
| SMILES | CC[C@@H](Sc1ccc(Cl)cc1)C(=O)N1CCN(c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C21H24Cl2N2OS/c1-3-20(27-18-8-6-16(22)7-9-18)21(26)25-12-10-24(11-13-25)19-14-17(23)5-4-15(19)2/h4-9,14,20H,3,10-13H2,1-2H3/t20-/m1/s1 |
| InChIKey | XKOACZWTKQCTHK-HXUWFJFHSA-N |
| XLogP | 5.52 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |