C16H21ClN2O3S — CID 132899265
ethyl 4-[2-(4-chlorophenyl)sulfanylpropanoyl]piperazine-1-carboxylate (PubChem CID 132899265) has the molecular formula C16H21ClN2O3S and a molecular weight of 356.88 g/mol. Its IUPAC name is ethyl 4-[2-(4-chlorophenyl)sulfanylpropanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(4-chlorophenyl)sulfanylpropanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 132899265 |
| Molecular Formula | C16H21ClN2O3S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | ethyl 4-[2-(4-chlorophenyl)sulfanylpropanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(C)Sc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H21ClN2O3S/c1-3-22-16(21)19-10-8-18(9-11-19)15(20)12(2)23-14-6-4-13(17)5-7-14/h4-7,12H,3,8-11H2,1-2H3 |
| InChIKey | BEPHMHVTQRLJEH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |