C20H21ClN2O3S — CID 86928896
2-(4-chlorophenyl)sulfanyl-1-[4-(4-hydroxybenzoyl)piperazin-1-yl]propan-1-one (PubChem CID 86928896) has the molecular formula C20H21ClN2O3S and a molecular weight of 404.92 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-1-[4-(4-hydroxybenzoyl)piperazin-1-yl]propan-1-one.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-1-[4-(4-hydroxybenzoyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 86928896 |
| Molecular Formula | C20H21ClN2O3S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-1-[4-(4-hydroxybenzoyl)piperazin-1-yl]propan-1-one |
| SMILES | CC(Sc1ccc(Cl)cc1)C(=O)N1CCN(C(=O)c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C20H21ClN2O3S/c1-14(27-18-8-4-16(21)5-9-18)19(25)22-10-12-23(13-11-22)20(26)15-2-6-17(24)7-3-15/h2-9,14,24H,10-13H2,1H3 |
| InChIKey | OUPHUEFPJZZDKD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |