C15H19ClN2O2S — CID 3859595
1-[2-(4-chlorophenyl)sulfanylpropanoyl]piperidine-4-carboxamide (PubChem CID 3859595) has the molecular formula C15H19ClN2O2S and a molecular weight of 326.85 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylpropanoyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylpropanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3859595 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylpropanoyl]piperidine-4-carboxamide |
| SMILES | CC(Sc1ccc(Cl)cc1)C(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C15H19ClN2O2S/c1-10(21-13-4-2-12(16)3-5-13)15(20)18-8-6-11(7-9-18)14(17)19/h2-5,10-11H,6-9H2,1H3,(H2,17,19) |
| InChIKey | HMIGQIINEDEFAN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |