C20H22Cl2N2O2 — CID 10318399
ethyl 4-[bis(4-chlorophenyl)methyl]piperazine-1-carboxylate (PubChem CID 10318399) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is ethyl 4-[bis(4-chlorophenyl)methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[bis(4-chlorophenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 10318399 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | ethyl 4-[bis(4-chlorophenyl)methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H22Cl2N2O2/c1-2-26-20(25)24-13-11-23(12-14-24)19(15-3-7-17(21)8-4-15)16-5-9-18(22)10-6-16/h3-10,19H,2,11-14H2,1H3 |
| InChIKey | XBWDFGLAYZYAIM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |