C21H19Cl2F3N2O3 — CID 140663928
(1,1,1-trifluoro-3-oxopropan-2-yl) 4-[bis(4-chlorophenyl)methyl]piperazine-1-carboxylate (PubChem CID 140663928) has the molecular formula C21H19Cl2F3N2O3 and a molecular weight of 475.29 g/mol. Its IUPAC name is (1,1,1-trifluoro-3-oxopropan-2-yl) 4-[bis(4-chlorophenyl)methyl]piperazine-1-carboxylate.
| Compound Name | (1,1,1-trifluoro-3-oxopropan-2-yl) 4-[bis(4-chlorophenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 140663928 |
| Molecular Formula | C21H19Cl2F3N2O3 |
| Molecular Weight | 475.29 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | (1,1,1-trifluoro-3-oxopropan-2-yl) 4-[bis(4-chlorophenyl)methyl]piperazine-1-carboxylate |
| SMILES | O=CC(OC(=O)N1CCN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C21H19Cl2F3N2O3/c22-16-5-1-14(2-6-16)19(15-3-7-17(23)8-4-15)27-9-11-28(12-10-27)20(30)31-18(13-29)21(24,25)26/h1-8,13,18-19H,9-12H2 |
| InChIKey | ARDGCVCWERQZGW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.29 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|