C25H23Cl2FN2O — CID 46100709
1-[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]-2-(4-fluorophenyl)ethanone (PubChem CID 46100709) has the molecular formula C25H23Cl2FN2O and a molecular weight of 457.38 g/mol. Its IUPAC name is 1-[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 46100709 |
| Molecular Formula | C25H23Cl2FN2O |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 1-[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]-2-(4-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)N1CCN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H23Cl2FN2O/c26-21-7-3-19(4-8-21)25(20-5-9-22(27)10-6-20)30-15-13-29(14-16-30)24(31)17-18-1-11-23(28)12-2-18/h1-12,25H,13-17H2 |
| InChIKey | OVZZTCDJXGFHCQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |