C19H17ClF2N2O2 — CID 86996657
2-(4-chlorophenyl)-1-[4-(3,5-difluorobenzoyl)piperazin-1-yl]ethanone (PubChem CID 86996657) has the molecular formula C19H17ClF2N2O2 and a molecular weight of 378.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[4-(3,5-difluorobenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-[4-(3,5-difluorobenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 86996657 |
| Molecular Formula | C19H17ClF2N2O2 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[4-(3,5-difluorobenzoyl)piperazin-1-yl]ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1)N1CCN(C(=O)c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C19H17ClF2N2O2/c20-15-3-1-13(2-4-15)9-18(25)23-5-7-24(8-6-23)19(26)14-10-16(21)12-17(22)11-14/h1-4,10-12H,5-9H2 |
| InChIKey | HYSXMYBNTPJQLF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |