C25H25ClFN3O — CID 92768403
N-[(4-chlorophenyl)methyl]-4-[(S)-(4-fluorophenyl)-phenylmethyl]piperazine-1-carboxamide (PubChem CID 92768403) has the molecular formula C25H25ClFN3O and a molecular weight of 437.95 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-[(S)-(4-fluorophenyl)-phenylmethyl]piperazine-1-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-[(S)-(4-fluorophenyl)-phenylmethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 92768403 |
| Molecular Formula | C25H25ClFN3O |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-[(S)-(4-fluorophenyl)-phenylmethyl]piperazine-1-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)N1CCN([C@@H](c2ccccc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H25ClFN3O/c26-22-10-6-19(7-11-22)18-28-25(31)30-16-14-29(15-17-30)24(20-4-2-1-3-5-20)21-8-12-23(27)13-9-21/h1-13,24H,14-18H2,(H,28,31)/t24-/m0/s1 |
| InChIKey | PZGOXKFOHYIBBE-DEOSSOPVSA-N |
| XLogP | 5.10 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |