C24H23ClFN3S — CID 2011627
4-[(S)-(4-chlorophenyl)-phenylmethyl]-N-(4-fluorophenyl)piperazine-1-carbothioamide (PubChem CID 2011627) has the molecular formula C24H23ClFN3S and a molecular weight of 439.99 g/mol. Its IUPAC name is 4-[(S)-(4-chlorophenyl)-phenylmethyl]-N-(4-fluorophenyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(S)-(4-chlorophenyl)-phenylmethyl]-N-(4-fluorophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2011627 |
| Molecular Formula | C24H23ClFN3S |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 4-[(S)-(4-chlorophenyl)-phenylmethyl]-N-(4-fluorophenyl)piperazine-1-carbothioamide |
| SMILES | Fc1ccc(NC(=S)N2CCN([C@@H](c3ccccc3)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H23ClFN3S/c25-20-8-6-19(7-9-20)23(18-4-2-1-3-5-18)28-14-16-29(17-15-28)24(30)27-22-12-10-21(26)11-13-22/h1-13,23H,14-17H2,(H,27,30)/t23-/m0/s1 |
| InChIKey | QQBDMUPATHSDRI-QHCPKHFHSA-N |
| XLogP | 5.58 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|