C18H18Cl2N4S2 — CID 4076221
1-N,4-N-bis(4-chlorophenyl)piperazine-1,4-dicarbothioamide (PubChem CID 4076221) has the molecular formula C18H18Cl2N4S2 and a molecular weight of 425.41 g/mol. Its IUPAC name is 1-N,4-N-bis(4-chlorophenyl)piperazine-1,4-dicarbothioamide.
| Compound Name | 1-N,4-N-bis(4-chlorophenyl)piperazine-1,4-dicarbothioamide |
|---|---|
| PubChem CID | 4076221 |
| Molecular Formula | C18H18Cl2N4S2 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 1-N,4-N-bis(4-chlorophenyl)piperazine-1,4-dicarbothioamide |
| SMILES | S=C(Nc1ccc(Cl)cc1)N1CCN(C(=S)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H18Cl2N4S2/c19-13-1-5-15(6-2-13)21-17(25)23-9-11-24(12-10-23)18(26)22-16-7-3-14(20)4-8-16/h1-8H,9-12H2,(H,21,25)(H,22,26) |
| InChIKey | FCWNQPGUAADBBZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|