C14H17ClN2O2S — CID 8743307
methyl 1-[(4-chlorophenyl)carbamothioyl]piperidine-4-carboxylate (PubChem CID 8743307) has the molecular formula C14H17ClN2O2S and a molecular weight of 312.82 g/mol. Its IUPAC name is methyl 1-[(4-chlorophenyl)carbamothioyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(4-chlorophenyl)carbamothioyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 8743307 |
| Molecular Formula | C14H17ClN2O2S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | methyl 1-[(4-chlorophenyl)carbamothioyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=S)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H17ClN2O2S/c1-19-13(18)10-6-8-17(9-7-10)14(20)16-12-4-2-11(15)3-5-12/h2-5,10H,6-9H2,1H3,(H,16,20) |
| InChIKey | BPQVVISGRMKHPN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|