C17H24N2O3S — CID 701838
ethyl 1-[(4-ethoxyphenyl)carbamothioyl]piperidine-4-carboxylate (PubChem CID 701838) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is ethyl 1-[(4-ethoxyphenyl)carbamothioyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(4-ethoxyphenyl)carbamothioyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 701838 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | ethyl 1-[(4-ethoxyphenyl)carbamothioyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=S)Nc2ccc(OCC)cc2)CC1 |
| InChI | InChI=1S/C17H24N2O3S/c1-3-21-15-7-5-14(6-8-15)18-17(23)19-11-9-13(10-12-19)16(20)22-4-2/h5-8,13H,3-4,9-12H2,1-2H3,(H,18,23) |
| InChIKey | ZPWBSEKIXLZEIH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|